CAS 1152574-17-8 appears in our catalog under these names: 4-(3,5-Dimethyl-1h-pyrazol-1-yl)-2-(trifluoromethyl)benzonitrile, 95%, 4-(3,5-Dimethyl-1H-pyrazol-1-yl)-2-(trifluoromethyl)benzonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)benzonitrile (CAS 1152574-17-8) is a chemical compound with the molecular formula C13H10F3N3 and a molecular weight of 265.23 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)benzonitrile. InChIKey: DTBSPBRLAFAIOA-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N3 |
|---|---|
| Molecular weight | 265.23 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)-2-(trifluoromethyl)benzonitrile |
| InChIKey | DTBSPBRLAFAIOA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=CC(=C(C=C2)C#N)C(F)(F)F)C |
Computed by PubChem (NCBI)