Products 1034048-49-1
CAS 1034048-49-1 is the registry number for Cendifensine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3,4-dichlorophenyl)-[(3S)-3-propylpyrrolidin-3-yl]methanone (CAS 1034048-49-1) is a chemical compound with the molecular formula C14H17Cl2NO and a molecular weight of 286.2 g/mol. IUPAC name: (3,4-dichlorophenyl)-[(3S)-3-propylpyrrolidin-3-yl]methanone. InChIKey: HVLPRTLORBIKNG-AWEZNQCLSA-N.
| Molecular formula | C14H17Cl2NO |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-[(3S)-3-propylpyrrolidin-3-yl]methanone |
| InChIKey | HVLPRTLORBIKNG-AWEZNQCLSA-N |
| SMILES | CCC[C@@]1(CCNC1)C(=O)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)