CAS 54403-20-2 is the registry number for Sercloremine (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine;hydrochloride (CAS 54403-20-2) is a chemical compound with the molecular formula C14H17Cl2NO and a molecular weight of 286.2 g/mol. IUPAC name: 4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine;hydrochloride. InChIKey: RTLGMUXJYFSHMM-UHFFFAOYSA-N.
| Molecular formula | C14H17Cl2NO |
|---|---|
| Molecular weight | 286.2 g/mol |
| IUPAC name | 4-(5-chloro-1-benzofuran-2-yl)-1-methylpiperidine;hydrochloride |
| InChIKey | RTLGMUXJYFSHMM-UHFFFAOYSA-N |
| SMILES | CN1CCC(CC1)C2=CC3=C(O2)C=CC(=C3)Cl.Cl |
Computed by PubChem (NCBI)