Products 103417-69-2
CAS 103417-69-2 is the registry number for Wy 27569. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-O-ethyl 5-O-methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 103417-69-2) is a chemical compound with the molecular formula C21H22N4O6 and a molecular weight of 426.4 g/mol. IUPAC name: 3-O-ethyl 5-O-methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: BFLKGKGRZKABHQ-UHFFFAOYSA-N.
| Molecular formula | C21H22N4O6 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | 3-O-ethyl 5-O-methyl 2-(imidazol-1-ylmethyl)-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | BFLKGKGRZKABHQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(NC(=C(C1C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC)C)CN3C=CN=C3 |
Computed by PubChem (NCBI)