CAS 1034297-58-9 appears in our catalog under these names: CRT5, CRT5, 98.70%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 1 mg.
3-[6-amino-5-(6-ethoxynaphthalen-2-yl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide (CAS 1034297-58-9) is a chemical compound with the molecular formula C28H30N4O2 and a molecular weight of 454.6 g/mol. IUPAC name: 3-[6-amino-5-(6-ethoxynaphthalen-2-yl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide. InChIKey: XBDRAUPLGHAFCU-UHFFFAOYSA-N.
| Molecular formula | C28H30N4O2 |
|---|---|
| Molecular weight | 454.6 g/mol |
| IUPAC name | 3-[6-amino-5-(6-ethoxynaphthalen-2-yl)-3-pyridinyl]-N-[2-(dimethylamino)ethyl]benzamide |
| InChIKey | XBDRAUPLGHAFCU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C=C1)C=C(C=C2)C3=C(N=CC(=C3)C4=CC(=CC=C4)C(=O)NCCN(C)C)N |
Computed by PubChem (NCBI)