Products 2093946-08-6

CAS 2093946-08-6 is the registry number for YQ456, 99.84%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 10mM/1mL, 5 mg, 25 mg.

Structural formula: {0} (CAS {1})

3-[3-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide (CAS 2093946-08-6) is a chemical compound with the molecular formula C28H30N4O2 and a molecular weight of 454.6 g/mol. IUPAC name: 3-[3-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide. InChIKey: MSZAOWHKERXHJX-UHFFFAOYSA-N.

Identity
Molecular formulaC28H30N4O2
Molecular weight454.6 g/mol
IUPAC name3-[3-ethyl-5-(4-methoxyphenyl)-1,2,4-triazol-1-yl]-N-(4-phenylbutyl)benzamide
InChIKeyMSZAOWHKERXHJX-UHFFFAOYSA-N
SMILESCCC1=NN(C(=N1)C2=CC=C(C=C2)OC)C3=CC=CC(=C3)C(=O)NCCCCC4=CC=CC=C4

Computed by PubChem (NCBI)