CAS 103435-88-7 appears in our catalog under these names: Bortezomib Impurity 77, 2-(1H-Imidazole-1-carbonyl)pyrazine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Imidazol-1-yl(pyrazin-2-yl)methanone (CAS 103435-88-7) is a chemical compound with the molecular formula C8H6N4O and a molecular weight of 174.16 g/mol. IUPAC name: imidazol-1-yl(pyrazin-2-yl)methanone. InChIKey: KNYAJWGPAFZFOP-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | imidazol-1-yl(pyrazin-2-yl)methanone |
| InChIKey | KNYAJWGPAFZFOP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)