CAS 14506-41-3 is the registry number for 5-Benzoyl-2H-1,2,3,4-tetrazole. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 0,5g, 50mg.
Phenyl(2H-tetrazol-5-yl)methanone (CAS 14506-41-3) is a chemical compound with the molecular formula C8H6N4O and a molecular weight of 174.16 g/mol. IUPAC name: phenyl(2H-tetrazol-5-yl)methanone. InChIKey: IYLAFLZKTGDJQK-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | phenyl(2H-tetrazol-5-yl)methanone |
| InChIKey | IYLAFLZKTGDJQK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NNN=N2 |
Computed by PubChem (NCBI)