CAS 1034921-32-8 is the registry number for 7-Bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol (CAS 1034921-32-8) is a chemical compound with the molecular formula C10H10BrFO and a molecular weight of 245.09 g/mol. IUPAC name: 7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol. InChIKey: CQQDCTKRPFJLMW-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO |
|---|---|
| Molecular weight | 245.09 g/mol |
| IUPAC name | 7-bromo-5-fluoro-1,2,3,4-tetrahydronaphthalen-1-ol |
| InChIKey | CQQDCTKRPFJLMW-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C1)C(=CC(=C2)Br)F)O |
Computed by PubChem (NCBI)