CAS 103548-16-9 appears in our catalog under these names: (R)-1-Phenyl-1,3-propanediol, 95%, (1R)-1-Phenyl-1,3-propanediol, (R)-1-Phenyl-1,3-propanediol, 98%. Offered by: Combi-blocks, TRC, Thermo Scientific (Acros). Available pack sizes: 1g, 500mg, 5g.
(1R)-1-phenylpropane-1,3-diol (CAS 103548-16-9) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: (1R)-1-phenylpropane-1,3-diol. InChIKey: RRVFYOSEKOTFOG-SECBINFHSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | (1R)-1-phenylpropane-1,3-diol |
| InChIKey | RRVFYOSEKOTFOG-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CCO)O |
Computed by PubChem (NCBI)