CAS 1035840-48-2 appears in our catalog under these names: 1-(5-tert-Butyl-1,3-benzoxazol-2-yl)piperidin-4-amine hydrochloride, 95%, 1-(5-(tert-Butyl)benzo[d]oxazol-2-yl)piperidin-4-amine 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 5g, 250mg, 1g, 50mg, 100mg.
1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidin-4-amine (CAS 1035840-48-2) is a chemical compound with the molecular formula C16H23N3O and a molecular weight of 273.37 g/mol. IUPAC name: 1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidin-4-amine. InChIKey: LFHMIFVRARWHCA-UHFFFAOYSA-N.
| Molecular formula | C16H23N3O |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | 1-(5-tert-butyl-1,3-benzoxazol-2-yl)piperidin-4-amine |
| InChIKey | LFHMIFVRARWHCA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC2=C(C=C1)OC(=N2)N3CCC(CC3)N |
Computed by PubChem (NCBI)