Products 338975-38-5
CAS 338975-38-5 is the registry number for (2E)-3-(Dimethylamino)-1-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-3-(dimethylamino)-1-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one (CAS 338975-38-5) is a chemical compound with the molecular formula C16H23N3O and a molecular weight of 273.37 g/mol. IUPAC name: (E)-3-(dimethylamino)-1-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one. InChIKey: QIFZNYMETCIZKN-CMDGGOBGSA-N.
| Molecular formula | C16H23N3O |
|---|---|
| Molecular weight | 273.37 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-1-[4-(4-methylpiperazin-1-yl)phenyl]prop-2-en-1-one |
| InChIKey | QIFZNYMETCIZKN-CMDGGOBGSA-N |
| SMILES | CN1CCN(CC1)C2=CC=C(C=C2)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)