Products 1035844-55-3
CAS 1035844-55-3 is the registry number for 1-Allyl-3-(2,4,6-trimethylphenyl) imidazolium bromide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g.
1-prop-2-enyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium bromide (CAS 1035844-55-3) is a chemical compound with the molecular formula C15H19BrN2 and a molecular weight of 307.23 g/mol. IUPAC name: 1-prop-2-enyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium bromide. InChIKey: KMLMFXQYOWEODH-UHFFFAOYSA-M.
| Molecular formula | C15H19BrN2 |
|---|---|
| Molecular weight | 307.23 g/mol |
| IUPAC name | 1-prop-2-enyl-3-(2,4,6-trimethylphenyl)imidazol-1-ium bromide |
| InChIKey | KMLMFXQYOWEODH-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=C[N+](=C2)CC=C)C.[Br-] |
Computed by PubChem (NCBI)