Products 1821379-63-8
CAS 1821379-63-8 is the registry number for (S)-Pirlindole Hydrobromide. Offered by: TRC. Available pack sizes: 100mg.
(5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrobromide (CAS 1821379-63-8) is a chemical compound with the molecular formula C15H19BrN2 and a molecular weight of 307.23 g/mol. IUPAC name: (5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrobromide. InChIKey: RSMSQMLSZXGGGF-ZOWNYOTGSA-N.
| Molecular formula | C15H19BrN2 |
|---|---|
| Molecular weight | 307.23 g/mol |
| IUPAC name | (5S)-12-methyl-1,4-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10(15),11,13-tetraene;hydrobromide |
| InChIKey | RSMSQMLSZXGGGF-ZOWNYOTGSA-N |
| SMILES | CC1=CC2=C(C=C1)N3CCN[C@@H]4C3=C2CCC4.Br |
Computed by PubChem (NCBI)