CAS 1035968-08-1 is the registry number for (2R)-2-Amino-N,2-diphenylacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(2R)-2-amino-N,2-diphenylacetamide (CAS 1035968-08-1) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: (2R)-2-amino-N,2-diphenylacetamide. InChIKey: HCLZWWBOYHLGME-CYBMUJFWSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | (2R)-2-amino-N,2-diphenylacetamide |
| InChIKey | HCLZWWBOYHLGME-CYBMUJFWSA-N |
| SMILES | C1=CC=C(C=C1)[C@H](C(=O)NC2=CC=CC=C2)N |
Computed by PubChem (NCBI)