CAS 1036262-56-2 appears in our catalog under these names: cis-Azetidine-2,4-diyldimethanol hydrochloride, 97%, cis-Azetidine-2,4-diyldimethanol hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
[(2S,4R)-4-(hydroxymethyl)azetidin-2-yl]methanol;hydrochloride (CAS 1036262-56-2) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 153.61 g/mol. IUPAC name: [(2S,4R)-4-(hydroxymethyl)azetidin-2-yl]methanol;hydrochloride. InChIKey: DZLQHAIPYMAAIQ-JEVYUYNZSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 153.61 g/mol |
| IUPAC name | [(2S,4R)-4-(hydroxymethyl)azetidin-2-yl]methanol;hydrochloride |
| InChIKey | DZLQHAIPYMAAIQ-JEVYUYNZSA-N |
| SMILES | C1[C@@H](N[C@@H]1CO)CO.Cl |
Computed by PubChem (NCBI)