CAS 1036309-51-9 is the registry number for 3-(4-Bromophenyl)thieno[3,2-c]pyridin-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromophenyl)thieno[3,2-c]pyridin-4-amine (CAS 1036309-51-9) is a chemical compound with the molecular formula C13H9BrN2S and a molecular weight of 305.19 g/mol. IUPAC name: 3-(4-bromophenyl)thieno[3,2-c]pyridin-4-amine. InChIKey: DCNQMANPFWTSQQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 3-(4-bromophenyl)thieno[3,2-c]pyridin-4-amine |
| InChIKey | DCNQMANPFWTSQQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CSC3=C2C(=NC=C3)N)Br |
Computed by PubChem (NCBI)