CAS 1095528-03-2 is the registry number for 4-(5-Bromo-1,3-benzothiazol-2-yl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(5-bromo-1,3-benzothiazol-2-yl)aniline (CAS 1095528-03-2) is a chemical compound with the molecular formula C13H9BrN2S and a molecular weight of 305.19 g/mol. IUPAC name: 4-(5-bromo-1,3-benzothiazol-2-yl)aniline. InChIKey: OZUUVIQWYSHVRU-UHFFFAOYSA-N.
| Molecular formula | C13H9BrN2S |
|---|---|
| Molecular weight | 305.19 g/mol |
| IUPAC name | 4-(5-bromo-1,3-benzothiazol-2-yl)aniline |
| InChIKey | OZUUVIQWYSHVRU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(S2)C=CC(=C3)Br)N |
Computed by PubChem (NCBI)