Products 1036389-72-6
CAS 1036389-72-6 is the registry number for tert-Butyl 5-amino-3-oxo-2,3-dihydro-1h-indazole-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Tert-butyl 5-amino-3-oxo-2H-indazole-1-carboxylate (CAS 1036389-72-6) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: tert-butyl 5-amino-3-oxo-2H-indazole-1-carboxylate. InChIKey: MYJZYQJOXJNACN-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | tert-butyl 5-amino-3-oxo-2H-indazole-1-carboxylate |
| InChIKey | MYJZYQJOXJNACN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=C(C=C(C=C2)N)C(=O)N1 |
Computed by PubChem (NCBI)