CAS 926257-88-7 is the registry number for 1-(3-Nitro-4-piperazin-1-ylphenyl)ethanone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3-nitro-4-piperazin-1-ylphenyl)ethanone (CAS 926257-88-7) is a chemical compound with the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. IUPAC name: 1-(3-nitro-4-piperazin-1-ylphenyl)ethanone. InChIKey: GHEDOFZBDHZHEP-UHFFFAOYSA-N.
| Molecular formula | C12H15N3O3 |
|---|---|
| Molecular weight | 249.27 g/mol |
| IUPAC name | 1-(3-nitro-4-piperazin-1-ylphenyl)ethanone |
| InChIKey | GHEDOFZBDHZHEP-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)N2CCNCC2)[N+](=O)[O-] |
Computed by PubChem (NCBI)