CAS 10364-00-8 is the registry number for 5-Ethyladamantane-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-ethyladamantane-1,3-diol (CAS 10364-00-8) is a chemical compound with the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. IUPAC name: 5-ethyladamantane-1,3-diol. InChIKey: UBZYZZAIOTYCAB-UHFFFAOYSA-N.
| Molecular formula | C12H20O2 |
|---|---|
| Molecular weight | 196.29 g/mol |
| IUPAC name | 5-ethyladamantane-1,3-diol |
| InChIKey | UBZYZZAIOTYCAB-UHFFFAOYSA-N |
| SMILES | CCC12CC3CC(C1)(CC(C3)(C2)O)O |
Computed by PubChem (NCBI)