CAS 1036585-24-6 is the registry number for 3-Amino-2-methylbenzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-amino-2-methylbenzenesulfonamide (CAS 1036585-24-6) is a chemical compound with the molecular formula C7H10N2O2S and a molecular weight of 186.23 g/mol. IUPAC name: 3-amino-2-methylbenzenesulfonamide. InChIKey: SYTWUEBLPSAYDE-UHFFFAOYSA-N.
| Molecular formula | C7H10N2O2S |
|---|---|
| Molecular weight | 186.23 g/mol |
| IUPAC name | 3-amino-2-methylbenzenesulfonamide |
| InChIKey | SYTWUEBLPSAYDE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1S(=O)(=O)N)N |
Computed by PubChem (NCBI)