Products 1036593-47-1
CAS 1036593-47-1 is the registry number for 2-Bromo-1-[(4-methoxyphenyl)methoxy]-4-methylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
2-bromo-1-[(4-methoxyphenyl)methoxy]-4-methylbenzene (CAS 1036593-47-1) is a chemical compound with the molecular formula C15H15BrO2 and a molecular weight of 307.18 g/mol. IUPAC name: 2-bromo-1-[(4-methoxyphenyl)methoxy]-4-methylbenzene. InChIKey: OFAJHXKBYXPWDE-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO2 |
|---|---|
| Molecular weight | 307.18 g/mol |
| IUPAC name | 2-bromo-1-[(4-methoxyphenyl)methoxy]-4-methylbenzene |
| InChIKey | OFAJHXKBYXPWDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC2=CC=C(C=C2)OC)Br |
Computed by PubChem (NCBI)