Products 929000-22-6
CAS 929000-22-6 appears in our catalog under these names: t-Butyl 4-bromo-1-naphthoate, 96%, tert–Butyl 4–bromo–1–naphthoate, tert-Butyl 4-bromo-1-naphthoate 96%, tert-Butyl 4-bromo-1-naphthoate, 96%, 96%, tert-Butyl 4-bromo-1-naphthoate, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 5g, 25g, 1g, 100mg.
Tert-butyl 4-bromonaphthalene-1-carboxylate (CAS 929000-22-6) is a chemical compound with the molecular formula C15H15BrO2 and a molecular weight of 307.18 g/mol. IUPAC name: tert-butyl 4-bromonaphthalene-1-carboxylate. InChIKey: JCSZXGTXRLOCHN-UHFFFAOYSA-N.
| Molecular formula | C15H15BrO2 |
|---|---|
| Molecular weight | 307.18 g/mol |
| IUPAC name | tert-butyl 4-bromonaphthalene-1-carboxylate |
| InChIKey | JCSZXGTXRLOCHN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C2=CC=CC=C21)Br |
Computed by PubChem (NCBI)