Products 1036711-64-4
CAS 1036711-64-4 is the registry number for Phloroglucinol-d3. Offered by: Chemat Brand. Available pack sizes: on request.
2,4,6-trideuteriobenzene-1,3,5-triol (CAS 1036711-64-4) is a chemical compound with the molecular formula C6H6O3 and a molecular weight of 129.13 g/mol. IUPAC name: 2,4,6-trideuteriobenzene-1,3,5-triol. InChIKey: QCDYQQDYXPDABM-CBYSEHNBSA-N.
| Molecular formula | C6H6O3 |
|---|---|
| Molecular weight | 129.13 g/mol |
| IUPAC name | 2,4,6-trideuteriobenzene-1,3,5-triol |
| InChIKey | QCDYQQDYXPDABM-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1O)[2H])O)[2H])O |
Computed by PubChem (NCBI)