Products 1329497-24-6
CAS 1329497-24-6 appears in our catalog under these names: benzene-1,3,5-triol-1,2,3,4,5,6-13C6, Phloroglucinol-13C6, >95% (HPLC), Phloroglucinol-13C6. Offered by: Chemat Brand, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3,5-triol (CAS 1329497-24-6) is a chemical compound with the molecular formula C6H6O3 and a molecular weight of 132.066 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3,5-triol. InChIKey: QCDYQQDYXPDABM-IDEBNGHGSA-N.
| Molecular formula | C6H6O3 |
|---|---|
| Molecular weight | 132.066 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3,5-triol |
| InChIKey | QCDYQQDYXPDABM-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13C]([13CH]=[13C]([13CH]=[13C]1O)O)O |
Computed by PubChem (NCBI)