CAS 10368-44-2 appears in our catalog under these names: trans–2–Bromo–1–indanol, Trans-2-bromo-1-indanol, 97%, trans-2-Bromo-2,3-dihydro-1H-inden-1-ol. Offered by: GLPBio, Combi-blocks, Chemat. Available pack sizes: 100g, 25g, 1g, 5g.
(1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol (CAS 10368-44-2) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: RTESDSDXFLYAKZ-RKDXNWHRSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1R,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | RTESDSDXFLYAKZ-RKDXNWHRSA-N |
| SMILES | C1[C@H]([C@@H](C2=CC=CC=C21)O)Br |
Computed by PubChem (NCBI)