Products 252984-60-4
CAS 252984-60-4 appears in our catalog under these names: Rac-(1r,2s)-2-bromo-2,3-dihydro-1h-inden-1-ol, 95%, rac-(1R,2S)-2-Bromo-2,3-dihydro-1H-inden-1-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 2,5g.
(1S,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol (CAS 252984-60-4) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: (1S,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol. InChIKey: RTESDSDXFLYAKZ-BDAKNGLRSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | (1S,2R)-2-bromo-2,3-dihydro-1H-inden-1-ol |
| InChIKey | RTESDSDXFLYAKZ-BDAKNGLRSA-N |
| SMILES | C1[C@H]([C@H](C2=CC=CC=C21)O)Br |
Computed by PubChem (NCBI)