CAS 10368-47-5 appears in our catalog under these names: 2,4,6-Triphenylnitrobenzene, 95%, 2,4,6–Triphenylnitrobenzene, 2,4,6-Triphenylnitrobenzene, >98.0%(GC), 2,4,6-Triphenylnitrobenzene, 98%, 98%, 2'-Nitro-5'-phenyl-1,1':3',1''-terphenyl, 98%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
2-nitro-1,3,5-triphenylbenzene (CAS 10368-47-5) is a chemical compound with the molecular formula C24H17NO2 and a molecular weight of 351.4 g/mol. IUPAC name: 2-nitro-1,3,5-triphenylbenzene. InChIKey: VCRVMYZAKLXTFQ-UHFFFAOYSA-N.
| Molecular formula | C24H17NO2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | 2-nitro-1,3,5-triphenylbenzene |
| InChIKey | VCRVMYZAKLXTFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)C3=CC=CC=C3)[N+](=O)[O-])C4=CC=CC=C4 |
Computed by PubChem (NCBI)