CAS 2368851-20-9 is the registry number for (S)-8,9A-diphenyl-9,9a-dihydropyrido[1,2-a]indole-6,10-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(9aS)-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione (CAS 2368851-20-9) is a chemical compound with the molecular formula C24H17NO2 and a molecular weight of 351.4 g/mol. IUPAC name: (9aS)-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione. InChIKey: JBUGZIFHNLOALD-DEOSSOPVSA-N.
| Molecular formula | C24H17NO2 |
|---|---|
| Molecular weight | 351.4 g/mol |
| IUPAC name | (9aS)-8,9a-diphenyl-9H-pyrido[1,2-a]indole-6,10-dione |
| InChIKey | JBUGZIFHNLOALD-DEOSSOPVSA-N |
| SMILES | C1C(=CC(=O)N2[C@]1(C(=O)C3=CC=CC=C32)C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)