CAS 103691-51-6 appears in our catalog under these names: Diethanolamine-d8, >95% (HPLC), Bis(2-hydroxyethyl)-d8-amine, 98 atom % D, min 98% Chemical Purity, Diethanolamine–D8, D8-Diethanolamine, Concentration: 100 µg/ml Solvent: Acetonitrile, D8-Diethanolamine. Offered by: TRC, CDN, GLPBio, HPC Standards. Available pack sizes: 100mg, 10mg, 0,5g, 0,25g, 1x1ml, 1x10mg.
1,1,2,2-tetradeuterio-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]ethanol (CAS 103691-51-6) is a chemical compound with the molecular formula C4H11NO2 and a molecular weight of 113.18 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]ethanol. InChIKey: ZBCBWPMODOFKDW-SVYQBANQSA-N.
| Molecular formula | C4H11NO2 |
|---|---|
| Molecular weight | 113.18 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-[(1,1,2,2-tetradeuterio-2-hydroxyethyl)amino]ethanol |
| InChIKey | ZBCBWPMODOFKDW-SVYQBANQSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)NC([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)