CAS 1219804-08-6 is the registry number for Bis(2-hydroxyethyl)amine-d11, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
N,1,1,2,2-pentadeuterio-2-deuteriooxy-N-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)ethanamine (CAS 1219804-08-6) is a chemical compound with the molecular formula C4H11NO2 and a molecular weight of 116.20 g/mol. IUPAC name: N,1,1,2,2-pentadeuterio-2-deuteriooxy-N-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)ethanamine. InChIKey: ZBCBWPMODOFKDW-DEEHOQBLSA-N.
| Molecular formula | C4H11NO2 |
|---|---|
| Molecular weight | 116.20 g/mol |
| IUPAC name | N,1,1,2,2-pentadeuterio-2-deuteriooxy-N-(1,1,2,2-tetradeuterio-2-deuteriooxyethyl)ethanamine |
| InChIKey | ZBCBWPMODOFKDW-DEEHOQBLSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O[2H])N([2H])C([2H])([2H])C([2H])([2H])O[2H] |
Computed by PubChem (NCBI)