CAS 1037559-82-2 appears in our catalog under these names: (1R,2S,5S)-6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile, 95%, Nirmatrelvir Impurity 60, (1R,2S,5S)-6,6-Dimethyl-3-azabicyclo(3.1.0)hexane-2-carbonitrile. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 75mg.
(1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile (CAS 1037559-82-2) is a chemical compound with the molecular formula C8H12N2 and a molecular weight of 136.19 g/mol. IUPAC name: (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile. InChIKey: ZLISHYOBWCRHFE-XVMARJQXSA-N.
| Molecular formula | C8H12N2 |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
| InChIKey | ZLISHYOBWCRHFE-XVMARJQXSA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@H](NC2)C#N)C |
Computed by PubChem (NCBI)