CAS 1037559-85-5 is the registry number for (1S,2R,5R)-6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,2R,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile (CAS 1037559-85-5) is a chemical compound with the molecular formula C8H12N2 and a molecular weight of 136.19 g/mol. IUPAC name: (1S,2R,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile. InChIKey: ZLISHYOBWCRHFE-DSYKOEDSSA-N.
| Molecular formula | C8H12N2 |
|---|---|
| Molecular weight | 136.19 g/mol |
| IUPAC name | (1S,2R,5R)-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carbonitrile |
| InChIKey | ZLISHYOBWCRHFE-DSYKOEDSSA-N |
| SMILES | CC1([C@H]2[C@@H]1[C@@H](NC2)C#N)C |
Computed by PubChem (NCBI)