CAS 1037763-48-6 is the registry number for 5-Amino-4,6-dibromo-2,2-difluorobenzodioxole, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4,6-dibromo-2,2-difluoro-1,3-benzodioxol-5-amine (CAS 1037763-48-6) is a chemical compound with the molecular formula C7H3Br2F2NO2 and a molecular weight of 330.91 g/mol. IUPAC name: 4,6-dibromo-2,2-difluoro-1,3-benzodioxol-5-amine. InChIKey: CFCPODBJJBRXPL-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F2NO2 |
|---|---|
| Molecular weight | 330.91 g/mol |
| IUPAC name | 4,6-dibromo-2,2-difluoro-1,3-benzodioxol-5-amine |
| InChIKey | CFCPODBJJBRXPL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Br)N)Br)OC(O2)(F)F |
Computed by PubChem (NCBI)