CAS 2222512-05-0 is the registry number for 1,4-Dibromo-2,5-difluoro-6-methyl-3-nitrobenzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
1,4-dibromo-2,5-difluoro-3-methyl-6-nitrobenzene (CAS 2222512-05-0) is a chemical compound with the molecular formula C7H3Br2F2NO2 and a molecular weight of 330.91 g/mol. IUPAC name: 1,4-dibromo-2,5-difluoro-3-methyl-6-nitrobenzene. InChIKey: PBAKMHZMYBBQKN-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F2NO2 |
|---|---|
| Molecular weight | 330.91 g/mol |
| IUPAC name | 1,4-dibromo-2,5-difluoro-3-methyl-6-nitrobenzene |
| InChIKey | PBAKMHZMYBBQKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)F)[N+](=O)[O-])Br)F |
Computed by PubChem (NCBI)