Products 1037775-97-5
CAS 1037775-97-5 is the registry number for 6-Chloro-8-phenyl-3,4-dihydro-2H-1,4-ethano-1,5-naphthyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-phenyl-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene (CAS 1037775-97-5) is a chemical compound with the molecular formula C16H15ClN2 and a molecular weight of 270.75 g/mol. IUPAC name: 5-chloro-3-phenyl-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene. InChIKey: UEIHTCDJCYQSGZ-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | 5-chloro-3-phenyl-1,6-diazatricyclo[6.2.2.02,7]dodeca-2(7),3,5-triene |
| InChIKey | UEIHTCDJCYQSGZ-UHFFFAOYSA-N |
| SMILES | C1CN2CCC1C3=C2C(=CC(=N3)Cl)C4=CC=CC=C4 |
Computed by PubChem (NCBI)