CAS 141472-79-9 appears in our catalog under these names: 1-(4-Chlorobenzyl)-5,6-dimethyl-1h-benzimidazole, 95%, 1-(4-Chlorobenzyl)-5,6-dimethyl-1H-benzimidazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazole (CAS 141472-79-9) is a chemical compound with the molecular formula C16H15ClN2 and a molecular weight of 270.75 g/mol. IUPAC name: 1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazole. InChIKey: AGMQHEBJQCVRFK-UHFFFAOYSA-N.
| Molecular formula | C16H15ClN2 |
|---|---|
| Molecular weight | 270.75 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)methyl]-5,6-dimethylbenzimidazole |
| InChIKey | AGMQHEBJQCVRFK-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N(C=N2)CC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)