CAS 103782-76-9 is the registry number for 1,1,1-Tris(hydroxymethyl)propane-d5, >95% (GC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
1,1,3,3-tetradeuterio-2-[deuterio(hydroxy)methyl]-2-ethylpropane-1,3-diol (CAS 103782-76-9) is a chemical compound with the molecular formula C6H14O3 and a molecular weight of 139.20 g/mol. IUPAC name: 1,1,3,3-tetradeuterio-2-[deuterio(hydroxy)methyl]-2-ethylpropane-1,3-diol. InChIKey: ZJCCRDAZUWHFQH-CZMJLJOYSA-N.
| Molecular formula | C6H14O3 |
|---|---|
| Molecular weight | 139.20 g/mol |
| IUPAC name | 1,1,3,3-tetradeuterio-2-[deuterio(hydroxy)methyl]-2-ethylpropane-1,3-diol |
| InChIKey | ZJCCRDAZUWHFQH-CZMJLJOYSA-N |
| SMILES | [2H]C(C(CC)(C([2H])([2H])O)C([2H])([2H])O)O |
Computed by PubChem (NCBI)