CAS 103797-22-4 appears in our catalog under these names: MEthyl 2-(3-nitrophenyl)-2-methylpropanoate, 95%, methyl 2–methyl–2–(3–nitrophenyl)propanoate, METHYL 2-(3-NITROPHENYL)-2-METHYLPROPANOATE. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
Methyl 2-methyl-2-(3-nitrophenyl)propanoate (CAS 103797-22-4) is a chemical compound with the molecular formula C11H13NO4 and a molecular weight of 223.22 g/mol. IUPAC name: methyl 2-methyl-2-(3-nitrophenyl)propanoate. InChIKey: UXYZPBKSIFDTJL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | methyl 2-methyl-2-(3-nitrophenyl)propanoate |
| InChIKey | UXYZPBKSIFDTJL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)