CAS 1038-95-5 appears in our catalog under these names: Tri(p–tolyl)phosphine, Tri-p-tolyl phosphine, Tri(p-tolyl)phosphine, >96.0%(GC), Tri-p-tolylphosphine, 98%, Tri-p-Tolylphosphine, 96%, 96%. Offered by: GLPBio, Biosynth, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100g, 500g, 25g, 10g, 5g, 1g, 50g, 250g.
Tris(4-methylphenyl)phosphane (CAS 1038-95-5) is a chemical compound with the molecular formula C21H21P and a molecular weight of 304.4 g/mol. IUPAC name: tris(4-methylphenyl)phosphane. InChIKey: WXAZIUYTQHYBFW-UHFFFAOYSA-N.
| Molecular formula | C21H21P |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tris(4-methylphenyl)phosphane |
| InChIKey | WXAZIUYTQHYBFW-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)P(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C |
Computed by PubChem (NCBI)