CAS 6224-63-1 appears in our catalog under these names: Tri(3-tolyl)phosphine/ 98+%, Tri(m–tolyl)phosphine, Tri(m-tolyl)phosphine, 98+% , Tri(m-tolyl)phosphine, >98.0%(GC), Tri-m-tolylphosphine 98%. Offered by: Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 100g, 25g, 5g, 500g, 50g, 10g.
Tris(3-methylphenyl)phosphane (CAS 6224-63-1) is a chemical compound with the molecular formula C21H21P and a molecular weight of 304.4 g/mol. IUPAC name: tris(3-methylphenyl)phosphane. InChIKey: LFNXCUNDYSYVJY-UHFFFAOYSA-N.
| Molecular formula | C21H21P |
|---|---|
| Molecular weight | 304.4 g/mol |
| IUPAC name | tris(3-methylphenyl)phosphane |
| InChIKey | LFNXCUNDYSYVJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)P(C2=CC=CC(=C2)C)C3=CC=CC(=C3)C |
Computed by PubChem (NCBI)