Products 103802-41-1
CAS 103802-41-1 appears in our catalog under these names: 6-Ethyl-4-hydroxyquinoline-3-carboxylic acid, 97%, 6-Ethyl-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 98%. Offered by: Ambeed, BLDpharm, Fluorochem. Available pack sizes: 1g, 5g.
6-ethyl-4-oxo-1H-quinoline-3-carboxylic acid (CAS 103802-41-1) is a chemical compound with the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. IUPAC name: 6-ethyl-4-oxo-1H-quinoline-3-carboxylic acid. InChIKey: RESVKOSPFKHQBK-UHFFFAOYSA-N.
| Molecular formula | C12H11NO3 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 6-ethyl-4-oxo-1H-quinoline-3-carboxylic acid |
| InChIKey | RESVKOSPFKHQBK-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)