CAS 1038303-08-0 is the registry number for 1-(2,6-Difluorophenyl)-1H-1,3-benzodiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,6-difluorophenyl)benzimidazol-2-amine (CAS 1038303-08-0) is a chemical compound with the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. IUPAC name: 1-(2,6-difluorophenyl)benzimidazol-2-amine. InChIKey: INGLEMCAPWCJLU-UHFFFAOYSA-N.
| Molecular formula | C13H9F2N3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 1-(2,6-difluorophenyl)benzimidazol-2-amine |
| InChIKey | INGLEMCAPWCJLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C3=C(C=CC=C3F)F)N |
Computed by PubChem (NCBI)