CAS 1038711-47-5 appears in our catalog under these names: 1-(2,4-Difluorophenyl)-1H-1,3-benzodiazol-2-amine, 95%, 1-(2,4-Difluorophenyl)-1H-1,3-benzodiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(2,4-difluorophenyl)benzimidazol-2-amine (CAS 1038711-47-5) is a chemical compound with the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. IUPAC name: 1-(2,4-difluorophenyl)benzimidazol-2-amine. InChIKey: HTSPWAODZNVAGN-UHFFFAOYSA-N.
| Molecular formula | C13H9F2N3 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 1-(2,4-difluorophenyl)benzimidazol-2-amine |
| InChIKey | HTSPWAODZNVAGN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C3=C(C=C(C=C3)F)F)N |
Computed by PubChem (NCBI)