CAS 1038303-09-1 appears in our catalog under these names: 1-(2-Fluorophenyl)-1H-1,3-benzodiazol-2-amine, 1-(2-Fluorophenyl)-1H-1,3-benzodiazol-2-amine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-(2-fluorophenyl)benzimidazol-2-amine (CAS 1038303-09-1) is a chemical compound with the molecular formula C13H10FN3 and a molecular weight of 227.24 g/mol. IUPAC name: 1-(2-fluorophenyl)benzimidazol-2-amine. InChIKey: PDQPGKBWLNFWPE-UHFFFAOYSA-N.
| Molecular formula | C13H10FN3 |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 1-(2-fluorophenyl)benzimidazol-2-amine |
| InChIKey | PDQPGKBWLNFWPE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(N2C3=CC=CC=C3F)N |
Computed by PubChem (NCBI)