CAS 326883-87-8 appears in our catalog under these names: 2-(4-Fluorophenyl)imidazo[1,2-(a)]pyridin-3-amine, 95%, 2-(4-fluorophenyl)imidazo(1,2-{a})pyridin-3-amine, 95%, 2-(4-Fluorophenyl)imidazo(1,2-{A})pyridin-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 2,5g.
2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-amine (CAS 326883-87-8) is a chemical compound with the molecular formula C13H10FN3 and a molecular weight of 227.24 g/mol. IUPAC name: 2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-amine. InChIKey: ISVXYJZNORLRPH-UHFFFAOYSA-N.
| Molecular formula | C13H10FN3 |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 2-(4-fluorophenyl)imidazo[1,2-a]pyridin-3-amine |
| InChIKey | ISVXYJZNORLRPH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=C(N2C=C1)N)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)