CAS 1038304-09-4 appears in our catalog under these names: 5,5-Dimethyl-4H,5H-naphtho(1,2-b)thiophene-2-carboxylic acid, 95%, 5,5-Dimethyl-4H,5H-naphtho(1,2-b)thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
5,5-dimethyl-4H-benzo[g][1]benzothiole-2-carboxylic acid (CAS 1038304-09-4) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 258.3 g/mol. IUPAC name: 5,5-dimethyl-4H-benzo[g][1]benzothiole-2-carboxylic acid. InChIKey: PTOBLWZWMMBLGH-UHFFFAOYSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 5,5-dimethyl-4H-benzo[g][1]benzothiole-2-carboxylic acid |
| InChIKey | PTOBLWZWMMBLGH-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C3=CC=CC=C31)SC(=C2)C(=O)O)C |
Computed by PubChem (NCBI)