Products 1216659-66-3
CAS 1216659-66-3 appears in our catalog under these names: 2-((Diphenylmethyl)thio)acetic Acid-d10, 2-[(Diphenylmethyl)thio]acetic Acid-d10. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfanyl]acetic acid (CAS 1216659-66-3) is a chemical compound with the molecular formula C15H14O2S and a molecular weight of 268.40 g/mol. IUPAC name: 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfanyl]acetic acid. InChIKey: HTHFEDOFDBZPRX-LHNTUAQVSA-N.
| Molecular formula | C15H14O2S |
|---|---|
| Molecular weight | 268.40 g/mol |
| IUPAC name | 2-[bis(2,3,4,5,6-pentadeuteriophenyl)methylsulfanyl]acetic acid |
| InChIKey | HTHFEDOFDBZPRX-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])SCC(=O)O)[2H])[2H] |
Computed by PubChem (NCBI)