CAS 1038333-46-8 appears in our catalog under these names: 1-(4-Fluorophenyl)-1H-1,3-benzodiazole-2-thiol, 95%, 1-(4-Fluorophenyl)-1H-1,3-benzodiazole-2-thiol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-(4-fluorophenyl)-1H-benzimidazole-2-thione (CAS 1038333-46-8) is a chemical compound with the molecular formula C13H9FN2S and a molecular weight of 244.29 g/mol. IUPAC name: 3-(4-fluorophenyl)-1H-benzimidazole-2-thione. InChIKey: AJNDNJRXZKSEJY-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2S |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-1H-benzimidazole-2-thione |
| InChIKey | AJNDNJRXZKSEJY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(=S)N2C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)